About (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine
(2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine (PubChem CID 146426453) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine.
Molecular Properties
| Compound Name | (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine |
| PubChem CID | 146426453 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine |
| SMILES | C=CC(=N\C=C/N=C)/C(N)=C\C |
| InChI | InChI=1S/C9H13N3/c1-4-8(10)9(5-2)12-7-6-11-3/h4-7H,2-3,10H2,1H3/b7-6-,8-4+,12-9+ |
| InChIKey | QWMBWKISVTZCMI-KSKFPXHBSA-N |
| XLogP | 1.65 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine?
The IUPAC name of (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine (CID 146426453) is (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine.
What is the SMILES notation for (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine?
The canonical SMILES for (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine is C=CC(=N\C=C/N=C)/C(N)=C\C.
What is the InChIKey of (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine?
The InChIKey is QWMBWKISVTZCMI-KSKFPXHBSA-N. The full InChI is InChI=1S/C9H13N3/c1-4-8(10)9(5-2)12-7-6-11-3/h4-7H,2-3,10H2,1H3/b7-6-,8-4+,12-9+.
What are the key properties of (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine?
(2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine has a molecular weight of 163.22 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine is sourced from PubChem (CID 146426453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).