C9H13N3 — CID 146426453
(2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine (PubChem CID 146426453) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine.
| Compound Name | (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine |
|---|---|
| PubChem CID | 146426453 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (2E)-4-[(Z)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-3-amine |
| SMILES | C=CC(=N\C=C/N=C)/C(N)=C\C |
| InChI | InChI=1S/C9H13N3/c1-4-8(10)9(5-2)12-7-6-11-3/h4-7H,2-3,10H2,1H3/b7-6-,8-4+,12-9+ |
| InChIKey | QWMBWKISVTZCMI-KSKFPXHBSA-N |
| XLogP | 1.65 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|