C8H12N2 — CID 134360187
(4Z)-3-N-methyl-4-N-methylidenehexa-1,4-diene-3,4-diimine (PubChem CID 134360187) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (4Z)-3-N-methyl-4-N-methylidenehexa-1,4-diene-3,4-diimine.
| Compound Name | (4Z)-3-N-methyl-4-N-methylidenehexa-1,4-diene-3,4-diimine |
|---|---|
| PubChem CID | 134360187 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (4Z)-3-N-methyl-4-N-methylidenehexa-1,4-diene-3,4-diimine |
| SMILES | C=C/C(=N\C)C(=CC)N=C |
| InChI | InChI=1S/C8H12N2/c1-5-7(9-3)8(6-2)10-4/h5-6H,1,4H2,2-3H3/b8-6-,9-7+ |
| InChIKey | XSLYDGCHZQVSJF-MKKAVFGOSA-N |
| XLogP | 1.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|