About N-[(E)-but-2-en-2-yl]methanimine;ethane
N-[(E)-but-2-en-2-yl]methanimine;ethane (PubChem CID 145473397) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]methanimine;ethane.
Molecular Properties
| Compound Name | N-[(E)-but-2-en-2-yl]methanimine;ethane |
| PubChem CID | 145473397 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]methanimine;ethane |
| SMILES | C=N/C(C)=C/C.CC.CC |
| InChI | InChI=1S/C5H9N.2C2H6/c1-4-5(2)6-3;2*1-2/h4H,3H2,1-2H3;2*1-2H3/b5-4+;; |
| InChIKey | BZGRPXNRVNUZOE-SFKRKKMESA-N |
| XLogP | 3.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-en-2-yl]methanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-en-2-yl]methanimine;ethane?
The IUPAC name of N-[(E)-but-2-en-2-yl]methanimine;ethane (CID 145473397) is N-[(E)-but-2-en-2-yl]methanimine;ethane.
What is the SMILES notation for N-[(E)-but-2-en-2-yl]methanimine;ethane?
The canonical SMILES for N-[(E)-but-2-en-2-yl]methanimine;ethane is C=N/C(C)=C/C.CC.CC.
What is the InChIKey of N-[(E)-but-2-en-2-yl]methanimine;ethane?
The InChIKey is BZGRPXNRVNUZOE-SFKRKKMESA-N. The full InChI is InChI=1S/C5H9N.2C2H6/c1-4-5(2)6-3;2*1-2/h4H,3H2,1-2H3;2*1-2H3/b5-4+;;.
What are the key properties of N-[(E)-but-2-en-2-yl]methanimine;ethane?
N-[(E)-but-2-en-2-yl]methanimine;ethane has a molecular weight of 143.27 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-en-2-yl]methanimine;ethane is sourced from PubChem (CID 145473397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).