About N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane
N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane (PubChem CID 171626628) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane.
Molecular Properties
| Compound Name | N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane |
| PubChem CID | 171626628 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane |
| SMILES | C=C/C=C(/C)N=C.CCC |
| InChI | InChI=1S/C6H9N.C3H8/c1-4-5-6(2)7-3;1-3-2/h4-5H,1,3H2,2H3;3H2,1-2H3/b6-5-; |
| InChIKey | KYFKVKWUFSDGIF-YSMBQZINSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane?
The IUPAC name of N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane (CID 171626628) is N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane.
What is the SMILES notation for N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane?
The canonical SMILES for N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane is C=C/C=C(/C)N=C.CCC.
What is the InChIKey of N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane?
The InChIKey is KYFKVKWUFSDGIF-YSMBQZINSA-N. The full InChI is InChI=1S/C6H9N.C3H8/c1-4-5-6(2)7-3;1-3-2/h4-5H,1,3H2,2H3;3H2,1-2H3/b6-5-;.
What are the key properties of N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane?
N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane has a molecular weight of 139.24 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z)-penta-2,4-dien-2-yl]methanimine;propane is sourced from PubChem (CID 171626628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).