C9H14N2 — CID 166695623
(1E,3Z,4Z)-3-ethylidene-2-(methylideneamino)hexa-1,4-dien-1-amine (PubChem CID 166695623) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (1E,3Z,4Z)-3-ethylidene-2-(methylideneamino)hexa-1,4-dien-1-amine.
| Compound Name | (1E,3Z,4Z)-3-ethylidene-2-(methylideneamino)hexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 166695623 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (1E,3Z,4Z)-3-ethylidene-2-(methylideneamino)hexa-1,4-dien-1-amine |
| SMILES | C=N/C(=C/N)C(=CC)/C=C\C |
| InChI | InChI=1S/C9H14N2/c1-4-6-8(5-2)9(7-10)11-3/h4-7H,3,10H2,1-2H3/b6-4-,8-5-,9-7+ |
| InChIKey | JJIXCINVGWWESJ-KNPBSLPESA-N |
| XLogP | 2.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|