C38H53N — CID 141245832
N-[4,5,6,7,8,9,10,11,12,13-deca(ethylidene)hexadeca-2,14-dien-3-yl]ethanimine (PubChem CID 141245832) has the molecular formula C38H53N and a molecular weight of 523.85 g/mol. Its IUPAC name is N-[4,5,6,7,8,9,10,11,12,13-deca(ethylidene)hexadeca-2,14-dien-3-yl]ethanimine.
| Compound Name | N-[4,5,6,7,8,9,10,11,12,13-deca(ethylidene)hexadeca-2,14-dien-3-yl]ethanimine |
|---|---|
| PubChem CID | 141245832 |
| Molecular Formula | C38H53N |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.42 |
| IUPAC Name | N-[4,5,6,7,8,9,10,11,12,13-deca(ethylidene)hexadeca-2,14-dien-3-yl]ethanimine |
| SMILES | CC=CC(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)/N=C/C |
| InChI | InChI=1S/C38H53N/c1-14-27-28(15-2)29(16-3)30(17-4)31(18-5)32(19-6)33(20-7)34(21-8)35(22-9)36(23-10)37(24-11)38(25-12)39-26-13/h14-27H,1-13H3/b27-14?,28-15?,29-16?,30-17?,31-18?,32-19?,33-20?,34-21?,35-22?,36-23?,37-24?,38-25?,39-26+ |
| InChIKey | ZBUARWPOKHQPFV-TXPKXWRISA-N |
| XLogP | 12.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|