C19H39N — CID 144997637
ethane;N-[(2Z,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dien-3-yl]propan-2-imine (PubChem CID 144997637) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is ethane;N-[(2Z,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dien-3-yl]propan-2-imine.
| Compound Name | ethane;N-[(2Z,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dien-3-yl]propan-2-imine |
|---|---|
| PubChem CID | 144997637 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | ethane;N-[(2Z,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dien-3-yl]propan-2-imine |
| SMILES | CC.CC.CC.CC=C(N=C(C)C)C(/C=C\C)=C/CC |
| InChI | InChI=1S/C13H21N.3C2H6/c1-6-9-12(10-7-2)13(8-3)14-11(4)5;3*1-2/h6,8-10H,7H2,1-5H3;3*1-2H3/b9-6-,12-10+,13-8-;;; |
| InChIKey | AUKHRPRQULEWRX-RZOFJDAYSA-N |
| XLogP | 7.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|