C13H21N — CID 143918138
(1E,3E)-2-[(Z)-but-1-enyl]-3-[(Z)-prop-1-enyl]hexa-1,3-dien-1-amine (PubChem CID 143918138) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (1E,3E)-2-[(Z)-but-1-enyl]-3-[(Z)-prop-1-enyl]hexa-1,3-dien-1-amine.
| Compound Name | (1E,3E)-2-[(Z)-but-1-enyl]-3-[(Z)-prop-1-enyl]hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143918138 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (1E,3E)-2-[(Z)-but-1-enyl]-3-[(Z)-prop-1-enyl]hexa-1,3-dien-1-amine |
| SMILES | C/C=C\C(=C/CC)C(=CN)/C=C\CC |
| InChI | InChI=1S/C13H21N/c1-4-7-10-13(11-14)12(8-5-2)9-6-3/h5,7-11H,4,6,14H2,1-3H3/b8-5-,10-7-,12-9+,13-11+ |
| InChIKey | HXRAREIGMDPFKH-SZXPQPFKSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|