C17H25N — CID 126661770
(E)-5-methylidene-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-[(Z)-prop-1-enyl]hept-3-en-2-imine (PubChem CID 126661770) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (E)-5-methylidene-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-[(Z)-prop-1-enyl]hept-3-en-2-imine.
| Compound Name | (E)-5-methylidene-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-[(Z)-prop-1-enyl]hept-3-en-2-imine |
|---|---|
| PubChem CID | 126661770 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (E)-5-methylidene-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-[(Z)-prop-1-enyl]hept-3-en-2-imine |
| SMILES | C=C(/C=C(\C=C/C)C(/C)=N\C(=C/C)C(=C)C)CC |
| InChI | InChI=1S/C17H25N/c1-8-11-16(12-14(6)9-2)15(7)18-17(10-3)13(4)5/h8,10-12H,4,6,9H2,1-3,5,7H3/b11-8-,16-12+,17-10-,18-15+ |
| InChIKey | CIOMPCKSFVSCNS-DFYHDNDUSA-N |
| XLogP | 5.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|