C14H18F3N — CID 139518460
(E)-N-[(3E,5E)-7,7,7-trifluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]pent-3-en-2-imine (PubChem CID 139518460) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is (E)-N-[(3E,5E)-7,7,7-trifluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]pent-3-en-2-imine.
| Compound Name | (E)-N-[(3E,5E)-7,7,7-trifluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 139518460 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (E)-N-[(3E,5E)-7,7,7-trifluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]pent-3-en-2-imine |
| SMILES | C=C(C)C(=C\C=C(/C)C(F)(F)F)/N=C(C)/C=C/C |
| InChI | InChI=1S/C14H18F3N/c1-6-7-12(5)18-13(10(2)3)9-8-11(4)14(15,16)17/h6-9H,2H2,1,3-5H3/b7-6+,11-8+,13-9+,18-12+ |
| InChIKey | KTQVPIIANXNYGL-KKLKZLTESA-N |
| XLogP | 4.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|