C17H27F3N2 — CID 153345700
N'-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentanimidamide (PubChem CID 153345700) has the molecular formula C17H27F3N2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N'-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentanimidamide.
| Compound Name | N'-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentanimidamide |
|---|---|
| PubChem CID | 153345700 |
| Molecular Formula | C17H27F3N2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | N'-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentanimidamide |
| SMILES | CCC/C=C(C)/C(=C\C=C(/C)C(F)(F)F)/N=C(/N)CCCC |
| InChI | InChI=1S/C17H27F3N2/c1-5-7-9-13(3)15(22-16(21)10-8-6-2)12-11-14(4)17(18,19)20/h9,11-12H,5-8,10H2,1-4H3,(H2,21,22)/b13-9+,14-11+,15-12+ |
| InChIKey | PFVJTSCUJLHGSD-LNNCEKSTSA-N |
| XLogP | 5.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|