C16H29F3N2 — CID 142921333
(1E,3E)-1-N'-butyl-5,5,5-trifluoro-1-N,4-dimethyl-1-N'-pentylpenta-1,3-diene-1,1-diamine (PubChem CID 142921333) has the molecular formula C16H29F3N2 and a molecular weight of 306.42 g/mol. Its IUPAC name is (1E,3E)-1-N'-butyl-5,5,5-trifluoro-1-N,4-dimethyl-1-N'-pentylpenta-1,3-diene-1,1-diamine.
| Compound Name | (1E,3E)-1-N'-butyl-5,5,5-trifluoro-1-N,4-dimethyl-1-N'-pentylpenta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 142921333 |
| Molecular Formula | C16H29F3N2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (1E,3E)-1-N'-butyl-5,5,5-trifluoro-1-N,4-dimethyl-1-N'-pentylpenta-1,3-diene-1,1-diamine |
| SMILES | CCCCCN(CCCC)/C(=C/C=C(\C)C(F)(F)F)NC |
| InChI | InChI=1S/C16H29F3N2/c1-5-7-9-13-21(12-8-6-2)15(20-4)11-10-14(3)16(17,18)19/h10-11,20H,5-9,12-13H2,1-4H3/b14-10+,15-11+ |
| InChIKey | QIYTUKUJCCAEPO-WFYKWJGLSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|