C13H23F3N2O2 — CID 71671979
N-(dipentylcarbamoyl)-2,2,2-trifluoroacetamide (PubChem CID 71671979) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(dipentylcarbamoyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(dipentylcarbamoyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 71671979 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(dipentylcarbamoyl)-2,2,2-trifluoroacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O2/c1-3-5-7-9-18(10-8-6-4-2)12(20)17-11(19)13(14,15)16/h3-10H2,1-2H3,(H,17,19,20) |
| InChIKey | QFKYEEYLZOTIJP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|