C18H29F6N3O4 — CID 162211687
hexyl N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]carbamate (PubChem CID 162211687) has the molecular formula C18H29F6N3O4 and a molecular weight of 465.44 g/mol. Its IUPAC name is hexyl N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]carbamate.
| Compound Name | hexyl N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 162211687 |
| Molecular Formula | C18H29F6N3O4 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | hexyl N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]carbamate |
| SMILES | CCCCCCOC(=O)N(CCCCCNC(=O)C(F)(F)F)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H29F6N3O4/c1-2-3-4-8-13-31-16(30)27(12-10-26-15(29)18(22,23)24)11-7-5-6-9-25-14(28)17(19,20)21/h2-13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | ZSXRPMGMSPUXLX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|