C24H41F6N3O4 — CID 162144801
butyl N-[7-[(2,2,2-trifluoroacetyl)amino]heptyl]-N-[8-[(2,2,2-trifluoroacetyl)amino]octyl]carbamate (PubChem CID 162144801) has the molecular formula C24H41F6N3O4 and a molecular weight of 549.60 g/mol. Its IUPAC name is butyl N-[7-[(2,2,2-trifluoroacetyl)amino]heptyl]-N-[8-[(2,2,2-trifluoroacetyl)amino]octyl]carbamate.
| Compound Name | butyl N-[7-[(2,2,2-trifluoroacetyl)amino]heptyl]-N-[8-[(2,2,2-trifluoroacetyl)amino]octyl]carbamate |
|---|---|
| PubChem CID | 162144801 |
| Molecular Formula | C24H41F6N3O4 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | butyl N-[7-[(2,2,2-trifluoroacetyl)amino]heptyl]-N-[8-[(2,2,2-trifluoroacetyl)amino]octyl]carbamate |
| SMILES | CCCCOC(=O)N(CCCCCCCCNC(=O)C(F)(F)F)CCCCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H41F6N3O4/c1-2-3-19-37-22(36)33(18-14-10-6-8-12-16-32-21(35)24(28,29)30)17-13-9-5-4-7-11-15-31-20(34)23(25,26)27/h2-19H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | ZKKIEWIRVKUHSS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|