C19H31F6N3O4 — CID 154195296
butyl N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]carbamate (PubChem CID 154195296) has the molecular formula C19H31F6N3O4 and a molecular weight of 479.46 g/mol. Its IUPAC name is butyl N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]carbamate.
| Compound Name | butyl N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 154195296 |
| Molecular Formula | C19H31F6N3O4 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | butyl N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]carbamate |
| SMILES | CCCCOC(=O)N(CCCCCCNC(=O)C(F)(F)F)CCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H31F6N3O4/c1-2-3-14-32-17(31)28(13-9-7-11-27-16(30)19(23,24)25)12-8-5-4-6-10-26-15(29)18(20,21)22/h2-14H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | VHLQLXPUZAAEBK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|