C20H28F3N3O5 — CID 21308379
methyl-[(2R)-4-[phenylmethoxycarbonyl-[4-[(2,2,2-trifluoroacetyl)amino]butyl]amino]butan-2-yl]carbamic acid (PubChem CID 21308379) has the molecular formula C20H28F3N3O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is methyl-[(2R)-4-[phenylmethoxycarbonyl-[4-[(2,2,2-trifluoroacetyl)amino]butyl]amino]butan-2-yl]carbamic acid.
| Compound Name | methyl-[(2R)-4-[phenylmethoxycarbonyl-[4-[(2,2,2-trifluoroacetyl)amino]butyl]amino]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 21308379 |
| Molecular Formula | C20H28F3N3O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | methyl-[(2R)-4-[phenylmethoxycarbonyl-[4-[(2,2,2-trifluoroacetyl)amino]butyl]amino]butan-2-yl]carbamic acid |
| SMILES | C[C@H](CCN(CCCCNC(=O)C(F)(F)F)C(=O)OCc1ccccc1)N(C)C(=O)O |
| InChI | InChI=1S/C20H28F3N3O5/c1-15(25(2)18(28)29)10-13-26(12-7-6-11-24-17(27)20(21,22)23)19(30)31-14-16-8-4-3-5-9-16/h3-5,8-9,15H,6-7,10-14H2,1-2H3,(H,24,27)(H,28,29)/t15-/m1/s1 |
| InChIKey | AABRZMZUYKJSIA-OAHLLOKOSA-N |
| XLogP | 3.47 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|