C26H57N3Si — CID 123754586
1-N,1-N,1-N',1-N',2-N,2-N-hexabutyl-2-silylethene-1,1,2-triamine (PubChem CID 123754586) has the molecular formula C26H57N3Si and a molecular weight of 439.85 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N-hexabutyl-2-silylethene-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexabutyl-2-silylethene-1,1,2-triamine |
|---|---|
| PubChem CID | 123754586 |
| Molecular Formula | C26H57N3Si |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.43 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexabutyl-2-silylethene-1,1,2-triamine |
| SMILES | CCCCN(CCCC)C([SiH3])=C(N(CCCC)CCCC)N(CCCC)CCCC |
| InChI | InChI=1S/C26H57N3Si/c1-7-13-19-27(20-14-8-2)25(28(21-15-9-3)22-16-10-4)26(30)29(23-17-11-5)24-18-12-6/h7-24H2,1-6,30H3 |
| InChIKey | DSSXFPCBKUMCKF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|