C18H30ClN — CID 153345490
N-[(2E,4E,6E)-2-chloro-3,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine (PubChem CID 153345490) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is N-[(2E,4E,6E)-2-chloro-3,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine.
| Compound Name | N-[(2E,4E,6E)-2-chloro-3,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine |
|---|---|
| PubChem CID | 153345490 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-[(2E,4E,6E)-2-chloro-3,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine |
| SMILES | CCC/C=C(C)/C(=C\C(C)=C(/C)Cl)/N=C(\C)CCCC |
| InChI | InChI=1S/C18H30ClN/c1-7-9-11-14(3)18(13-15(4)17(6)19)20-16(5)12-10-8-2/h11,13H,7-10,12H2,1-6H3/b14-11+,17-15+,18-13+,20-16+ |
| InChIKey | WMOYTOJFAVKQHS-TYJYZVIKSA-N |
| XLogP | 6.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|