C19H32N2O — CID 153345655
N-[(2E,4E,6E)-6-methyl-2-morpholin-4-yldeca-2,4,6-trien-5-yl]butan-2-imine (PubChem CID 153345655) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is N-[(2E,4E,6E)-6-methyl-2-morpholin-4-yldeca-2,4,6-trien-5-yl]butan-2-imine.
| Compound Name | N-[(2E,4E,6E)-6-methyl-2-morpholin-4-yldeca-2,4,6-trien-5-yl]butan-2-imine |
|---|---|
| PubChem CID | 153345655 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N-[(2E,4E,6E)-6-methyl-2-morpholin-4-yldeca-2,4,6-trien-5-yl]butan-2-imine |
| SMILES | CCC/C=C(C)/C(=C\C=C(/C)N1CCOCC1)/N=C(\C)CC |
| InChI | InChI=1S/C19H32N2O/c1-6-8-9-16(3)19(20-17(4)7-2)11-10-18(5)21-12-14-22-15-13-21/h9-11H,6-8,12-15H2,1-5H3/b16-9+,18-10+,19-11+,20-17+ |
| InChIKey | IWSVQLNIUWSFNC-FSMZBCKSSA-N |
| XLogP | 4.72 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|