C14H27N — CID 166820191
1-hex-2-en-2-yl-3,6-dimethylazepane (PubChem CID 166820191) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 1-hex-2-en-2-yl-3,6-dimethylazepane.
| Compound Name | 1-hex-2-en-2-yl-3,6-dimethylazepane |
|---|---|
| PubChem CID | 166820191 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 1-hex-2-en-2-yl-3,6-dimethylazepane |
| SMILES | CCCC=C(C)N1CC(C)CCC(C)C1 |
| InChI | InChI=1S/C14H27N/c1-5-6-7-14(4)15-10-12(2)8-9-13(3)11-15/h7,12-13H,5-6,8-11H2,1-4H3 |
| InChIKey | WQBVOAOFTISTAV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |