C25H41NO — CID 155725846
3-methyl-5-[(1E,3E)-3-methyl-1-(2-methylcyclohexen-1-yl)hepta-1,3-dien-2-yl]iminononan-4-one (PubChem CID 155725846) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is 3-methyl-5-[(1E,3E)-3-methyl-1-(2-methylcyclohexen-1-yl)hepta-1,3-dien-2-yl]iminononan-4-one.
| Compound Name | 3-methyl-5-[(1E,3E)-3-methyl-1-(2-methylcyclohexen-1-yl)hepta-1,3-dien-2-yl]iminononan-4-one |
|---|---|
| PubChem CID | 155725846 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | 3-methyl-5-[(1E,3E)-3-methyl-1-(2-methylcyclohexen-1-yl)hepta-1,3-dien-2-yl]iminononan-4-one |
| SMILES | CCC/C=C(C)/C(=C\C1=C(C)CCCC1)/N=C(\CCCC)C(=O)C(C)CC |
| InChI | InChI=1S/C25H41NO/c1-7-10-14-21(6)24(18-22-16-13-12-15-20(22)5)26-23(17-11-8-2)25(27)19(4)9-3/h14,18-19H,7-13,15-17H2,1-6H3/b21-14+,24-18+,26-23+ |
| InChIKey | HDJKYMALVAGMPM-MSGQQVPPSA-N |
| XLogP | 7.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|