About 4-butan-2-yl-2,3-dimethyloct-4-ene
4-butan-2-yl-2,3-dimethyloct-4-ene (PubChem CID 123920720) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 4-butan-2-yl-2,3-dimethyloct-4-ene.
Molecular Properties
| Compound Name | 4-butan-2-yl-2,3-dimethyloct-4-ene |
| PubChem CID | 123920720 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 4-butan-2-yl-2,3-dimethyloct-4-ene |
| SMILES | CCCC=C(C(C)CC)C(C)C(C)C |
| InChI | InChI=1S/C14H28/c1-7-9-10-14(12(5)8-2)13(6)11(3)4/h10-13H,7-9H2,1-6H3 |
| InChIKey | ILZRHTKTPQVMAV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-yl-2,3-dimethyloct-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-2,3-dimethyloct-4-ene?
The IUPAC name of 4-butan-2-yl-2,3-dimethyloct-4-ene (CID 123920720) is 4-butan-2-yl-2,3-dimethyloct-4-ene.
What is the SMILES notation for 4-butan-2-yl-2,3-dimethyloct-4-ene?
The canonical SMILES for 4-butan-2-yl-2,3-dimethyloct-4-ene is CCCC=C(C(C)CC)C(C)C(C)C.
What is the InChIKey of 4-butan-2-yl-2,3-dimethyloct-4-ene?
The InChIKey is ILZRHTKTPQVMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-7-9-10-14(12(5)8-2)13(6)11(3)4/h10-13H,7-9H2,1-6H3.
What are the key properties of 4-butan-2-yl-2,3-dimethyloct-4-ene?
4-butan-2-yl-2,3-dimethyloct-4-ene has a molecular weight of 196.38 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-2,3-dimethyloct-4-ene is sourced from PubChem (CID 123920720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).