C11H23N — CID 174244077
N,2,3,5-tetramethylheptan-4-imine (PubChem CID 174244077) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is N,2,3,5-tetramethylheptan-4-imine.
| Compound Name | N,2,3,5-tetramethylheptan-4-imine |
|---|---|
| PubChem CID | 174244077 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N,2,3,5-tetramethylheptan-4-imine |
| SMILES | CCC(C)/C(=N\C)C(C)C(C)C |
| InChI | InChI=1S/C11H23N/c1-7-9(4)11(12-6)10(5)8(2)3/h8-10H,7H2,1-6H3/b12-11+ |
| InChIKey | WPSSSIIWTFWQDR-VAWYXSNFSA-N |
| XLogP | 3.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|