2-methyl-N-propan-2-ylbutanimidoyl fluoride

C8H16FN — CID 134344210

IUPAC2-methyl-N-propan-2-ylbutanimidoyl fluoride
SMILESCCC(C)/C(F)=N/C(C)C
InChIInChI=1S/C8H16FN/c1-5-7(4)8(9)10-6(2)3/h6-7H,5H2,1-4H3/b10-8-
InChIKeyKWZVHPWUYXHRKZ-NTMALXAHSA-N
MW145.22 g/mol
LogP2.81
Rot. Bonds3

About 2-methyl-N-propan-2-ylbutanimidoyl fluoride

2-methyl-N-propan-2-ylbutanimidoyl fluoride (PubChem CID 134344210) has the molecular formula C8H16FN and a molecular weight of 145.22 g/mol. Its IUPAC name is 2-methyl-N-propan-2-ylbutanimidoyl fluoride.

Molecular Properties

Compound Name2-methyl-N-propan-2-ylbutanimidoyl fluoride
PubChem CID134344210
Molecular FormulaC8H16FN
Molecular Weight145.22 g/mol
Exact Mass145.13
IUPAC Name2-methyl-N-propan-2-ylbutanimidoyl fluoride
SMILESCCC(C)/C(F)=N/C(C)C
InChIInChI=1S/C8H16FN/c1-5-7(4)8(9)10-6(2)3/h6-7H,5H2,1-4H3/b10-8-
InChIKeyKWZVHPWUYXHRKZ-NTMALXAHSA-N
XLogP2.81
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.22
LogP ≤ 52.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2-methyl-N-propan-2-ylbutanimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-N-propan-2-ylbutanimidoyl fluoride?
The IUPAC name of 2-methyl-N-propan-2-ylbutanimidoyl fluoride (CID 134344210) is 2-methyl-N-propan-2-ylbutanimidoyl fluoride.
What is the SMILES notation for 2-methyl-N-propan-2-ylbutanimidoyl fluoride?
The canonical SMILES for 2-methyl-N-propan-2-ylbutanimidoyl fluoride is CCC(C)/C(F)=N/C(C)C.
What is the InChIKey of 2-methyl-N-propan-2-ylbutanimidoyl fluoride?
The InChIKey is KWZVHPWUYXHRKZ-NTMALXAHSA-N. The full InChI is InChI=1S/C8H16FN/c1-5-7(4)8(9)10-6(2)3/h6-7H,5H2,1-4H3/b10-8-.
What are the key properties of 2-methyl-N-propan-2-ylbutanimidoyl fluoride?
2-methyl-N-propan-2-ylbutanimidoyl fluoride has a molecular weight of 145.22 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-propan-2-ylbutanimidoyl fluoride is sourced from PubChem (CID 134344210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).