About tris(carbonofluoridic acid);2-methylbutane
tris(carbonofluoridic acid);2-methylbutane (PubChem CID 175037504) has the molecular formula C8H15F3O6
and a molecular weight of 264.20 g/mol. Its IUPAC name is tris(carbonofluoridic acid);2-methylbutane.
Molecular Properties
| Compound Name | tris(carbonofluoridic acid);2-methylbutane |
| PubChem CID | 175037504 |
| Molecular Formula | C8H15F3O6 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | tris(carbonofluoridic acid);2-methylbutane |
| SMILES | CCC(C)C.O=C(O)F.O=C(O)F.O=C(O)F |
| InChI | InChI=1S/C5H12.3CHFO2/c1-4-5(2)3;3*2-1(3)4/h5H,4H2,1-3H3;3*(H,3,4) |
| InChIKey | UUJBYFYQOHBJQG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze tris(carbonofluoridic acid);2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(carbonofluoridic acid);2-methylbutane?
The IUPAC name of tris(carbonofluoridic acid);2-methylbutane (CID 175037504) is tris(carbonofluoridic acid);2-methylbutane.
What is the SMILES notation for tris(carbonofluoridic acid);2-methylbutane?
The canonical SMILES for tris(carbonofluoridic acid);2-methylbutane is CCC(C)C.O=C(O)F.O=C(O)F.O=C(O)F.
What is the InChIKey of tris(carbonofluoridic acid);2-methylbutane?
The InChIKey is UUJBYFYQOHBJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.3CHFO2/c1-4-5(2)3;3*2-1(3)4/h5H,4H2,1-3H3;3*(H,3,4).
What are the key properties of tris(carbonofluoridic acid);2-methylbutane?
tris(carbonofluoridic acid);2-methylbutane has a molecular weight of 264.20 g/mol, XLogP of 3.95, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(carbonofluoridic acid);2-methylbutane is sourced from PubChem (CID 175037504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).