About dihydroxy(oxo)phosphanium;2-methylbutane
dihydroxy(oxo)phosphanium;2-methylbutane (PubChem CID 87211582) has the molecular formula C5H14O3P+
and a molecular weight of 153.14 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-methylbutane.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;2-methylbutane |
| PubChem CID | 87211582 |
| Molecular Formula | C5H14O3P+ |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-methylbutane |
| SMILES | CCC(C)C.O=[P+](O)O |
| InChI | InChI=1S/C5H12.HO3P/c1-4-5(2)3;1-4(2)3/h5H,4H2,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | OZMUYOHEBRYIQY-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;2-methylbutane?
The IUPAC name of dihydroxy(oxo)phosphanium;2-methylbutane (CID 87211582) is dihydroxy(oxo)phosphanium;2-methylbutane.
What is the SMILES notation for dihydroxy(oxo)phosphanium;2-methylbutane?
The canonical SMILES for dihydroxy(oxo)phosphanium;2-methylbutane is CCC(C)C.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;2-methylbutane?
The InChIKey is OZMUYOHEBRYIQY-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H12.HO3P/c1-4-5(2)3;1-4(2)3/h5H,4H2,1-3H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;2-methylbutane?
dihydroxy(oxo)phosphanium;2-methylbutane has a molecular weight of 153.14 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;2-methylbutane is sourced from PubChem (CID 87211582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).