About methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate
methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate (PubChem CID 163858298) has the molecular formula C8H18INO
and a molecular weight of 271.14 g/mol. Its IUPAC name is methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate.
Molecular Properties
| Compound Name | methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate |
| PubChem CID | 163858298 |
| Molecular Formula | C8H18INO |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate |
| SMILES | CCI(C)/C(=N/C(C)C)OC |
| InChI | InChI=1S/C8H18INO/c1-6-9(4)8(11-5)10-7(2)3/h7H,6H2,1-5H3/b10-8- |
| InChIKey | PAGXSBKIFRKOEC-NTMALXAHSA-N |
| XLogP | 2.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate?
The IUPAC name of methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate (CID 163858298) is methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate.
What is the SMILES notation for methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate?
The canonical SMILES for methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate is CCI(C)/C(=N/C(C)C)OC.
What is the InChIKey of methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate?
The InChIKey is PAGXSBKIFRKOEC-NTMALXAHSA-N. The full InChI is InChI=1S/C8H18INO/c1-6-9(4)8(11-5)10-7(2)3/h7H,6H2,1-5H3/b10-8-.
What are the key properties of methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate?
methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate has a molecular weight of 271.14 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[ethyl(methyl)-λ3-iodanyl]-N-propan-2-ylmethanimidate is sourced from PubChem (CID 163858298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).