C19H41N7O — CID 71511720
1,3-bis[N,N'-di(propan-2-yl)carbamimidoyl]-2-(3-methoxypropyl)guanidine (PubChem CID 71511720) has the molecular formula C19H41N7O and a molecular weight of 383.59 g/mol. Its IUPAC name is 1,3-bis[N,N'-di(propan-2-yl)carbamimidoyl]-2-(3-methoxypropyl)guanidine.
| Compound Name | 1,3-bis[N,N'-di(propan-2-yl)carbamimidoyl]-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 71511720 |
| Molecular Formula | C19H41N7O |
| Molecular Weight | 383.59 g/mol |
| Exact Mass | 383.34 |
| IUPAC Name | 1,3-bis[N,N'-di(propan-2-yl)carbamimidoyl]-2-(3-methoxypropyl)guanidine |
| SMILES | COCCCN=C(N/C(=N/C(C)C)NC(C)C)N/C(=N/C(C)C)NC(C)C |
| InChI | InChI=1S/C19H41N7O/c1-13(2)21-18(22-14(3)4)25-17(20-11-10-12-27-9)26-19(23-15(5)6)24-16(7)8/h13-16H,10-12H2,1-9H3,(H4,20,21,22,23,24,25,26) |
| InChIKey | OXHKBOLQWNRDFM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|