C19H43N7 — CID 176528735
1-[2-[3-[bis(propan-2-ylamino)methylideneamino]propylamino]ethyl]-2,3-di(propan-2-yl)guanidine (PubChem CID 176528735) has the molecular formula C19H43N7 and a molecular weight of 369.60 g/mol. Its IUPAC name is 1-[2-[3-[bis(propan-2-ylamino)methylideneamino]propylamino]ethyl]-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-[2-[3-[bis(propan-2-ylamino)methylideneamino]propylamino]ethyl]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 176528735 |
| Molecular Formula | C19H43N7 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.36 |
| IUPAC Name | 1-[2-[3-[bis(propan-2-ylamino)methylideneamino]propylamino]ethyl]-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\NCCNCCCN=C(NC(C)C)NC(C)C)NC(C)C |
| InChI | InChI=1S/C19H43N7/c1-14(2)23-18(24-15(3)4)21-11-9-10-20-12-13-22-19(25-16(5)6)26-17(7)8/h14-17,20H,9-13H2,1-8H3,(H2,21,23,24)(H2,22,25,26) |
| InChIKey | CDEZJPXPFMRXAX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|