C19H42N6 — CID 176521189
1-[3-[bis(propan-2-ylamino)methylideneamino]pentyl]-2,3-di(propan-2-yl)guanidine (PubChem CID 176521189) has the molecular formula C19H42N6 and a molecular weight of 354.59 g/mol. Its IUPAC name is 1-[3-[bis(propan-2-ylamino)methylideneamino]pentyl]-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-[3-[bis(propan-2-ylamino)methylideneamino]pentyl]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 176521189 |
| Molecular Formula | C19H42N6 |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | 1-[3-[bis(propan-2-ylamino)methylideneamino]pentyl]-2,3-di(propan-2-yl)guanidine |
| SMILES | CCC(CCN/C(=N/C(C)C)NC(C)C)N=C(NC(C)C)NC(C)C |
| InChI | InChI=1S/C19H42N6/c1-10-17(25-19(23-15(6)7)24-16(8)9)11-12-20-18(21-13(2)3)22-14(4)5/h13-17H,10-12H2,1-9H3,(H2,20,21,22)(H2,23,24,25) |
| InChIKey | AUOHBPGEVCOYIZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|