C8H18N2 — CID 11205611
N,N'-di(propan-2-yl)ethanimidamide (PubChem CID 11205611) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)ethanimidamide.
| Compound Name | N,N'-di(propan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 11205611 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N,N'-di(propan-2-yl)ethanimidamide |
| SMILES | C/C(=N\C(C)C)NC(C)C |
| InChI | InChI=1S/C8H18N2/c1-6(2)9-8(5)10-7(3)4/h6-7H,1-5H3,(H,9,10) |
| InChIKey | SYCZCVFOEPCWBF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|