C16H36CoN4+2 — CID 172756363
cobalt(2+);bis(N,N'-di(propan-2-yl)ethanimidamide) (PubChem CID 172756363) has the molecular formula C16H36CoN4+2 and a molecular weight of 343.43 g/mol. Its IUPAC name is cobalt(2+);bis(N,N'-di(propan-2-yl)ethanimidamide).
| Compound Name | cobalt(2+);bis(N,N'-di(propan-2-yl)ethanimidamide) |
|---|---|
| PubChem CID | 172756363 |
| Molecular Formula | C16H36CoN4+2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | cobalt(2+);bis(N,N'-di(propan-2-yl)ethanimidamide) |
| SMILES | C/C(=N\C(C)C)NC(C)C.C/C(=N\C(C)C)NC(C)C.[Co+2] |
| InChI | InChI=1S/2C8H18N2.Co/c2*1-6(2)9-8(5)10-7(3)4;/h2*6-7H,1-5H3,(H,9,10);/q;;+2 |
| InChIKey | LBQSNYLQPZOXLY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|