C10H23N3 — CID 547015
1,2,3-tri(propan-2-yl)guanidine (PubChem CID 547015) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1,2,3-tri(propan-2-yl)guanidine.
| Compound Name | 1,2,3-tri(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 547015 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1,2,3-tri(propan-2-yl)guanidine |
| SMILES | CC(C)N=C(NC(C)C)NC(C)C |
| InChI | InChI=1S/C10H23N3/c1-7(2)11-10(12-8(3)4)13-9(5)6/h7-9H,1-6H3,(H2,11,12,13) |
| InChIKey | ALOOBTJGUXDERE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|