C10H22LiN3 — CID 101047341
lithium [N,N'-di(propan-2-yl)carbamimidoyl]-propan-2-ylazanide (PubChem CID 101047341) has the molecular formula C10H22LiN3 and a molecular weight of 191.25 g/mol. Its IUPAC name is lithium [N,N'-di(propan-2-yl)carbamimidoyl]-propan-2-ylazanide.
| Compound Name | lithium [N,N'-di(propan-2-yl)carbamimidoyl]-propan-2-ylazanide |
|---|---|
| PubChem CID | 101047341 |
| Molecular Formula | C10H22LiN3 |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.20 |
| IUPAC Name | lithium [N,N'-di(propan-2-yl)carbamimidoyl]-propan-2-ylazanide |
| SMILES | CC(C)/N=C(\[N-]C(C)C)NC(C)C.[Li+] |
| InChI | InChI=1S/C10H22N3.Li/c1-7(2)11-10(12-8(3)4)13-9(5)6;/h7-9H,1-6H3,(H-,11,12,13);/q-1;+1 |
| InChIKey | GCVRCFYFPSWZOA-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|