C13H32LiN3Si2 — CID 15871615
lithium propan-2-yl-[N'-propan-2-yl-N,N-bis(trimethylsilyl)carbamimidoyl]azanide (PubChem CID 15871615) has the molecular formula C13H32LiN3Si2 and a molecular weight of 293.53 g/mol. Its IUPAC name is lithium propan-2-yl-[N'-propan-2-yl-N,N-bis(trimethylsilyl)carbamimidoyl]azanide.
| Compound Name | lithium propan-2-yl-[N'-propan-2-yl-N,N-bis(trimethylsilyl)carbamimidoyl]azanide |
|---|---|
| PubChem CID | 15871615 |
| Molecular Formula | C13H32LiN3Si2 |
| Molecular Weight | 293.53 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | lithium propan-2-yl-[N'-propan-2-yl-N,N-bis(trimethylsilyl)carbamimidoyl]azanide |
| SMILES | CC(C)/N=C(\[N-]C(C)C)N([Si](C)(C)C)[Si](C)(C)C.[Li+] |
| InChI | InChI=1S/C13H32N3Si2.Li/c1-11(2)14-13(15-12(3)4)16(17(5,6)7)18(8,9)10;/h11-12H,1-10H3;/q-1;+1 |
| InChIKey | AZAUOVSMYZEJSQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|