About bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+)
bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) (PubChem CID 23231140) has the molecular formula C23H40N3Yb+2
and a molecular weight of 531.63 g/mol. Its IUPAC name is bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+).
Molecular Properties
| Compound Name | bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) |
| PubChem CID | 23231140 |
| Molecular Formula | C23H40N3Yb+2 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) |
| SMILES | C1CCCC1.C1CCCC1.CC(C)/N=C(\[N-]C(C)C)Nc1ccccc1.[Yb+3] |
| InChI | InChI=1S/C13H20N3.2C5H10.Yb/c1-10(2)14-13(15-11(3)4)16-12-8-6-5-7-9-12;2*1-2-4-5-3-1;/h5-11H,1-4H3,(H-,14,15,16);2*1-5H2;/q-1;;;+3 |
| InChIKey | RNBDICBBWTZWFG-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+)?
The IUPAC name of bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) (CID 23231140) is bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+).
What is the SMILES notation for bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+)?
The canonical SMILES for bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) is C1CCCC1.C1CCCC1.CC(C)/N=C(\[N-]C(C)C)Nc1ccccc1.[Yb+3].
What is the InChIKey of bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+)?
The InChIKey is RNBDICBBWTZWFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N3.2C5H10.Yb/c1-10(2)14-13(15-11(3)4)16-12-8-6-5-7-9-12;2*1-2-4-5-3-1;/h5-11H,1-4H3,(H-,14,15,16);2*1-5H2;/q-1;;;+3.
What are the key properties of bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+)?
bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) has a molecular weight of 531.63 g/mol, XLogP of 7.55, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopentane);(N-phenyl-N'-propan-2-ylcarbamimidoyl)-propan-2-ylazanide;ytterbium(3+) is sourced from PubChem (CID 23231140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).