C25H42BN3 — CID 132837308
1-dicyclohexylboranyl-3-phenyl-1,2-di(propan-2-yl)guanidine (PubChem CID 132837308) has the molecular formula C25H42BN3 and a molecular weight of 395.44 g/mol. Its IUPAC name is 1-dicyclohexylboranyl-3-phenyl-1,2-di(propan-2-yl)guanidine.
| Compound Name | 1-dicyclohexylboranyl-3-phenyl-1,2-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 132837308 |
| Molecular Formula | C25H42BN3 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.35 |
| IUPAC Name | 1-dicyclohexylboranyl-3-phenyl-1,2-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\Nc1ccccc1)N(B(C1CCCCC1)C1CCCCC1)C(C)C |
| InChI | InChI=1S/C25H42BN3/c1-20(2)27-25(28-24-18-12-7-13-19-24)29(21(3)4)26(22-14-8-5-9-15-22)23-16-10-6-11-17-23/h7,12-13,18-23H,5-6,8-11,14-17H2,1-4H3,(H,27,28) |
| InChIKey | WIJJHJYTFISBKZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|