C13H21N3 — CID 11226187
1-phenyl-2,3-di(propan-2-yl)guanidine (PubChem CID 11226187) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-phenyl-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-phenyl-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 11226187 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-phenyl-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(/Nc1ccccc1)NC(C)C |
| InChI | InChI=1S/C13H21N3/c1-10(2)14-13(15-11(3)4)16-12-8-6-5-7-9-12/h5-11H,1-4H3,(H2,14,15,16) |
| InChIKey | JZCZQPUVSJLUME-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|