C14H23N5 — CID 71530093
(1E)-1-[amino(anilino)methylidene]-2,3-di(propan-2-yl)guanidine (PubChem CID 71530093) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is (1E)-1-[amino(anilino)methylidene]-2,3-di(propan-2-yl)guanidine.
| Compound Name | (1E)-1-[amino(anilino)methylidene]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 71530093 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | (1E)-1-[amino(anilino)methylidene]-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(/N=C(\N)Nc1ccccc1)NC(C)C |
| InChI | InChI=1S/C14H23N5/c1-10(2)16-14(17-11(3)4)19-13(15)18-12-8-6-5-7-9-12/h5-11H,1-4H3,(H4,15,16,17,18,19) |
| InChIKey | FWZURWPDUGWRCL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|