About 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide
3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide (PubChem CID 107811857) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide.
Molecular Properties
| Compound Name | 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide |
| PubChem CID | 107811857 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide |
| SMILES | CC(C)/N=C(\N)Nc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C11H16N4O/c1-7(2)14-11(13)15-9-5-3-4-8(6-9)10(12)16/h3-7H,1-2H3,(H2,12,16)(H3,13,14,15) |
| InChIKey | ILEATNFJJUKQGO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide?
The IUPAC name of 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide (CID 107811857) is 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide.
What is the SMILES notation for 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide?
The canonical SMILES for 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide is CC(C)/N=C(\N)Nc1cccc(C(N)=O)c1.
What is the InChIKey of 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide?
The InChIKey is ILEATNFJJUKQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-7(2)14-11(13)15-9-5-3-4-8(6-9)10(12)16/h3-7H,1-2H3,(H2,12,16)(H3,13,14,15).
What are the key properties of 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide?
3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide has a molecular weight of 220.28 g/mol, XLogP of 0.92, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(N'-propan-2-ylcarbamimidoyl)amino]benzamide is sourced from PubChem (CID 107811857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).