C26H32N6O2 — CID 56649500
2-propan-2-yl-1-[4-[4-[4-[(N'-propan-2-ylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]guanidine (PubChem CID 56649500) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-propan-2-yl-1-[4-[4-[4-[(N'-propan-2-ylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]guanidine.
| Compound Name | 2-propan-2-yl-1-[4-[4-[4-[(N'-propan-2-ylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]guanidine |
|---|---|
| PubChem CID | 56649500 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-propan-2-yl-1-[4-[4-[4-[(N'-propan-2-ylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]guanidine |
| SMILES | CC(C)/N=C(\N)Nc1ccc(Oc2ccc(Oc3ccc(N/C(N)=N/C(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H32N6O2/c1-17(2)29-25(27)31-19-5-9-21(10-6-19)33-23-13-15-24(16-14-23)34-22-11-7-20(8-12-22)32-26(28)30-18(3)4/h5-18H,1-4H3,(H3,27,29,31)(H3,28,30,32) |
| InChIKey | DCZSQMUXVXRWFE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|