C16H22N4 — CID 121005240
1,2-di(propan-2-yl)-3-quinolin-2-ylguanidine (PubChem CID 121005240) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)-3-quinolin-2-ylguanidine.
| Compound Name | 1,2-di(propan-2-yl)-3-quinolin-2-ylguanidine |
|---|---|
| PubChem CID | 121005240 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1,2-di(propan-2-yl)-3-quinolin-2-ylguanidine |
| SMILES | CC(C)/N=C(/Nc1ccc2ccccc2n1)NC(C)C |
| InChI | InChI=1S/C16H22N4/c1-11(2)17-16(18-12(3)4)20-15-10-9-13-7-5-6-8-14(13)19-15/h5-12H,1-4H3,(H2,17,18,19,20) |
| InChIKey | IJRSKMOPAZPFBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|