C20H33N3 — CID 175454071
1-benzyl-1-cyclohexyl-2,3-di(propan-2-yl)guanidine (PubChem CID 175454071) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is 1-benzyl-1-cyclohexyl-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-benzyl-1-cyclohexyl-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 175454071 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | 1-benzyl-1-cyclohexyl-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\NC(C)C)N(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H33N3/c1-16(2)21-20(22-17(3)4)23(19-13-9-6-10-14-19)15-18-11-7-5-8-12-18/h5,7-8,11-12,16-17,19H,6,9-10,13-15H2,1-4H3,(H,21,22) |
| InChIKey | BNRYMZTYFIVPQG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|