C22H35N3S — CID 17065687
1-benzyl-3-cyclooctyl-1-(1-methylpiperidin-4-yl)thiourea (PubChem CID 17065687) has the molecular formula C22H35N3S and a molecular weight of 373.61 g/mol. Its IUPAC name is 1-benzyl-3-cyclooctyl-1-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 1-benzyl-3-cyclooctyl-1-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065687 |
| Molecular Formula | C22H35N3S |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 1-benzyl-3-cyclooctyl-1-(1-methylpiperidin-4-yl)thiourea |
| SMILES | CN1CCC(N(Cc2ccccc2)C(=S)NC2CCCCCCC2)CC1 |
| InChI | InChI=1S/C22H35N3S/c1-24-16-14-21(15-17-24)25(18-19-10-6-5-7-11-19)22(26)23-20-12-8-3-2-4-9-13-20/h5-7,10-11,20-21H,2-4,8-9,12-18H2,1H3,(H,23,26) |
| InChIKey | BYFVJXWMHKPKSW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|