C21H29N3S — CID 47085348
N-benzyl-N-(1-methylpiperidin-4-yl)-N'-propan-2-ylthiophene-2-carboximidamide (PubChem CID 47085348) has the molecular formula C21H29N3S and a molecular weight of 355.55 g/mol. Its IUPAC name is N-benzyl-N-(1-methylpiperidin-4-yl)-N'-propan-2-ylthiophene-2-carboximidamide.
| Compound Name | N-benzyl-N-(1-methylpiperidin-4-yl)-N'-propan-2-ylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 47085348 |
| Molecular Formula | C21H29N3S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-benzyl-N-(1-methylpiperidin-4-yl)-N'-propan-2-ylthiophene-2-carboximidamide |
| SMILES | CC(C)/N=C(\c1cccs1)N(Cc1ccccc1)C1CCN(C)CC1 |
| InChI | InChI=1S/C21H29N3S/c1-17(2)22-21(20-10-7-15-25-20)24(16-18-8-5-4-6-9-18)19-11-13-23(3)14-12-19/h4-10,15,17,19H,11-14,16H2,1-3H3/b22-21+ |
| InChIKey | WPTINNJWKGVMQE-QURGRASLSA-N |
| XLogP | 4.50 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|