C23H28N2O2S — CID 42947669
N-benzyl-N-(1-cyclopropylethyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 42947669) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is N-benzyl-N-(1-cyclopropylethyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-benzyl-N-(1-cyclopropylethyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42947669 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-benzyl-N-(1-cyclopropylethyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | CC(C1CC1)N(Cc1ccccc1)C(=O)C1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C23H28N2O2S/c1-17(19-11-12-19)25(15-18-7-3-2-4-8-18)22(26)20-9-5-13-24(16-20)23(27)21-10-6-14-28-21/h2-4,6-8,10,14,17,19-20H,5,9,11-13,15-16H2,1H3 |
| InChIKey | BSNFJDBRTOTBTQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |