C24H30N2O4S — CID 55555852
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate (PubChem CID 55555852) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55555852 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)COC(=O)C1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C24H30N2O4S/c1-24(2,3)26(15-18-9-5-4-6-10-18)21(27)17-30-23(29)19-11-7-13-25(16-19)22(28)20-12-8-14-31-20/h4-6,8-10,12,14,19H,7,11,13,15-17H2,1-3H3 |
| InChIKey | QQNYUUQNZHROFO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |