C21H30N2O4S — CID 55556918
[2-(cyclooctylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate (PubChem CID 55556918) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55556918 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CCCN(C(=O)c2cccs2)C1)NC1CCCCCCC1 |
| InChI | InChI=1S/C21H30N2O4S/c24-19(22-17-9-4-2-1-3-5-10-17)15-27-21(26)16-8-6-12-23(14-16)20(25)18-11-7-13-28-18/h7,11,13,16-17H,1-6,8-10,12,14-15H2,(H,22,24) |
| InChIKey | JDNUXJJWGDJDHI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |