C15H22N2OS — CID 83999954
[3-(cyclopentylamino)piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 83999954) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is [3-(cyclopentylamino)piperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [3-(cyclopentylamino)piperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 83999954 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [3-(cyclopentylamino)piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCCC(NC2CCCC2)C1 |
| InChI | InChI=1S/C15H22N2OS/c18-15(14-8-4-10-19-14)17-9-3-7-13(11-17)16-12-5-1-2-6-12/h4,8,10,12-13,16H,1-3,5-7,9,11H2 |
| InChIKey | HWXZEUZUEPTSSM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |